kasss03 kasss03

24-07-2020
Mathematics

contestada

HELPPPP Cos x cosy = 1/2(sin (x+y)+ sin (x-y)) true or false

HELPPPP Cos x cosy 12sin xy sin xy true or false class=

Respuesta :

cristhiansanchez94 cristhiansanchez94

26-07-2020

Answer:

Step-by-step explanation:

REcall that sin(a+b) = sin(a)cos(b)+cos(a)sin(b). Then

sin(a+b)+sin(a-b) = sin(a)cos(b)+cos(a)sin(b) + sin(a)cos(b) -cos(a)sin(b) = 2sin(a)cos(b). Then

sin(a)cos(b) = (1/2)(sin(a+b)+sin(a-b))

So it is false

Answer Link

Otras preguntas

LEARNING REFLECTION How can you use this information to strengthen your resilience? Think of a situation you can apply this to, as well as a strategy that might

20 points, please help. Geometry help needed. C is 56.55 D is 25.38

Given log Subscript 3 Baseline 2 almost-equals 0. 631 and log Subscript 3 Baseline 7 almost-equals 1. 771, what is log Subscript 3 Baseline 14?.

Lewis dot structure? SiS2

5. What type of slavery" is Einstein saying will befall those who do not follow his message?

The ladies speak of being put on a lorry what is a lorry?.

the supplement of an angle is 6 degree less than three times its supplement. find the angle

Help please I need it

Q&A - Furries Its become clear to me that many people are confused about what a furry is and will start to be against them after receiving an answer from a

What are stereotypes? explain in your own words