24-10-2016
Mathematics

contestada

The area of the triangle is calculated with the following formula A=1/2bh

Respuesta :

vincentraybon vincentraybon

24-10-2016

Ok so what's your question?

Answer Link

Otras preguntas

Which Amendment to the Constitution should have protected Japanese American civil liberties during WWII?

WILL GIVE BRAINLIEST ANSWER I TYPED ALL OF THIS PLEASE HELP ASAP 1. For what reason did John Stuart Mill believe the government should get involved in the econ

Complete the following equations by correctly matching the appropriate product.

How would you explain speed?

Help on math homework

evaluate |16 + (-9) +2|

About 2% of children in the United States are allergic to peanuts. Choose three children at random and let the random variable X X be the number in this sample

Blance this out please! Ba(CN)2+2H2SO4=BaSO4+2HCN

A bat and a ball cost one dollar and ten cents in total. The bat costs a dollar more than the ball. How much does the ball cost?

why are chemical changes considered "unseen" ?