aquagamingk2 aquagamingk2

26-02-2021
Geography

contestada

The ____ zone has the least saline water among all the zones of an estuary.

Respuesta :

sfnkdbiubi49930 sfnkdbiubi49930

08-03-2021

Answer:

Estuaries

Explanation:

Answer Link

Otras preguntas

Assume that the following variables have been defined in a program: int x = 10; int y = 20; int z = 30; Write a cout statement that displays the sum of the vari

Assume over a certain period of time the technology for producing compact disk players has improved, and over the same period of time the economy has moved into

A ball rolling across a field has an acceleration of -0.5 m/s 2. It rolls 12.5 m and then comes to a stop after 8 sec. What was the ball's initial velocity?

What is the compound of 'Fools rush in where angels fear to tread.'

Which section of the Wasatch Front fault system is most likely to be the next to experience a major earthquake?

Amyloidosis is caused by an abnormal deposition and accumulation of protein aggregates in tissues. How do proteins adopt and maintain a stable folded structure?

PbS(s)+4H2O2(aq)→PbSO4(s)+4H2O(l)PbS(s)+4H2O2(aq)→PbSO4(s)+4H2O(l) Express your answers as chemical symbols separated by a comma. Enter the oxidized element fir

True or False Assessment strategies must link directly back to those identified in the instructional objectives.

A pollster agency wants to estimate the proportion of citizens of the European Union who support same-sex unions. She claims that if the sample size is large

what did most of the first state constitutions have in common